About 2-N-(4-amino-4-ethylhexyl)benzene-1,2-diamine;hydrochloride
2-N-(4-amino-4-ethylhexyl)benzene-1,2-diamine;hydrochloride (PubChem CID 173205667) has the molecular formula C14H26ClN3
and a molecular weight of 271.84 g/mol. Its IUPAC name is 2-N-(4-amino-4-ethylhexyl)benzene-1,2-diamine;hydrochloride.
Molecular Properties
| Compound Name | 2-N-(4-amino-4-ethylhexyl)benzene-1,2-diamine;hydrochloride |
| PubChem CID | 173205667 |
| Molecular Formula | C14H26ClN3 |
| Molecular Weight | 271.84 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 2-N-(4-amino-4-ethylhexyl)benzene-1,2-diamine;hydrochloride |
| SMILES | CCC(N)(CC)CCCNc1ccccc1N.Cl |
| InChI | InChI=1S/C14H25N3.ClH/c1-3-14(16,4-2)10-7-11-17-13-9-6-5-8-12(13)15;/h5-6,8-9,17H,3-4,7,10-11,15-16H2,1-2H3;1H |
| InChIKey | HGTYVBOJAUEAIZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.84 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(4-amino-4-ethylhexyl)benzene-1,2-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(4-amino-4-ethylhexyl)benzene-1,2-diamine;hydrochloride?
The IUPAC name of 2-N-(4-amino-4-ethylhexyl)benzene-1,2-diamine;hydrochloride (CID 173205667) is 2-N-(4-amino-4-ethylhexyl)benzene-1,2-diamine;hydrochloride.
What is the SMILES notation for 2-N-(4-amino-4-ethylhexyl)benzene-1,2-diamine;hydrochloride?
The canonical SMILES for 2-N-(4-amino-4-ethylhexyl)benzene-1,2-diamine;hydrochloride is CCC(N)(CC)CCCNc1ccccc1N.Cl.
What is the InChIKey of 2-N-(4-amino-4-ethylhexyl)benzene-1,2-diamine;hydrochloride?
The InChIKey is HGTYVBOJAUEAIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3.ClH/c1-3-14(16,4-2)10-7-11-17-13-9-6-5-8-12(13)15;/h5-6,8-9,17H,3-4,7,10-11,15-16H2,1-2H3;1H.
What are the key properties of 2-N-(4-amino-4-ethylhexyl)benzene-1,2-diamine;hydrochloride?
2-N-(4-amino-4-ethylhexyl)benzene-1,2-diamine;hydrochloride has a molecular weight of 271.84 g/mol, XLogP of 3.40, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(4-amino-4-ethylhexyl)benzene-1,2-diamine;hydrochloride is sourced from PubChem (CID 173205667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).