C18H18ClNO4 — CID 173208401
3-(4-amino-3-methoxyphenyl)-2-chloro-1-(2,5-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 173208401) has the molecular formula C18H18ClNO4 and a molecular weight of 347.80 g/mol. Its IUPAC name is 3-(4-amino-3-methoxyphenyl)-2-chloro-1-(2,5-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(4-amino-3-methoxyphenyl)-2-chloro-1-(2,5-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 173208401 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 3-(4-amino-3-methoxyphenyl)-2-chloro-1-(2,5-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(OC)c(C(=O)C(Cl)=Cc2ccc(N)c(OC)c2)c1 |
| InChI | InChI=1S/C18H18ClNO4/c1-22-12-5-7-16(23-2)13(10-12)18(21)14(19)8-11-4-6-15(20)17(9-11)24-3/h4-10H,20H2,1-3H3 |
| InChIKey | WYYRIHHJXBSAID-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|