C20H22BrNO6 — CID 173208856
3-(4-amino-3-methoxyphenyl)-2-bromo-1-(2,3,4,5-tetramethoxyphenyl)prop-2-en-1-one (PubChem CID 173208856) has the molecular formula C20H22BrNO6 and a molecular weight of 452.30 g/mol. Its IUPAC name is 3-(4-amino-3-methoxyphenyl)-2-bromo-1-(2,3,4,5-tetramethoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(4-amino-3-methoxyphenyl)-2-bromo-1-(2,3,4,5-tetramethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 173208856 |
| Molecular Formula | C20H22BrNO6 |
| Molecular Weight | 452.30 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | 3-(4-amino-3-methoxyphenyl)-2-bromo-1-(2,3,4,5-tetramethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C=C(Br)C(=O)c2cc(OC)c(OC)c(OC)c2OC)ccc1N |
| InChI | InChI=1S/C20H22BrNO6/c1-24-15-9-11(6-7-14(15)22)8-13(21)17(23)12-10-16(25-2)19(27-4)20(28-5)18(12)26-3/h6-10H,22H2,1-5H3 |
| InChIKey | GCDSCSWRSBHTAR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|