C10H13N3O4S — CID 173212283
4-[[3-(cyanomethylamino)-2-methylsulfanyl-3-oxopropyl]amino]-4-oxobut-2-enoic acid (PubChem CID 173212283) has the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. Its IUPAC name is 4-[[3-(cyanomethylamino)-2-methylsulfanyl-3-oxopropyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[[3-(cyanomethylamino)-2-methylsulfanyl-3-oxopropyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 173212283 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 4-[[3-(cyanomethylamino)-2-methylsulfanyl-3-oxopropyl]amino]-4-oxobut-2-enoic acid |
| SMILES | CSC(CNC(=O)C=CC(=O)O)C(=O)NCC#N |
| InChI | InChI=1S/C10H13N3O4S/c1-18-7(10(17)12-5-4-11)6-13-8(14)2-3-9(15)16/h2-3,7H,5-6H2,1H3,(H,12,17)(H,13,14)(H,15,16) |
| InChIKey | YZDBWJWQPCLNQI-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|