C33H36N4O4 — CID 173218476
2-[2-benzyl-3-[2-(hydroxyamino)-2-oxoethyl]-5,5-dimethylpyrrolidin-3-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide (PubChem CID 173218476) has the molecular formula C33H36N4O4 and a molecular weight of 552.68 g/mol. Its IUPAC name is 2-[2-benzyl-3-[2-(hydroxyamino)-2-oxoethyl]-5,5-dimethylpyrrolidin-3-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide.
| Compound Name | 2-[2-benzyl-3-[2-(hydroxyamino)-2-oxoethyl]-5,5-dimethylpyrrolidin-3-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 173218476 |
| Molecular Formula | C33H36N4O4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 2-[2-benzyl-3-[2-(hydroxyamino)-2-oxoethyl]-5,5-dimethylpyrrolidin-3-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
| SMILES | Cc1cc(COc2ccc(C(N)=O)c(C3(CC(=O)NO)CC(C)(C)NC3Cc3ccccc3)c2)c2ccccc2n1 |
| InChI | InChI=1S/C33H36N4O4/c1-21-15-23(25-11-7-8-12-28(25)35-21)19-41-24-13-14-26(31(34)39)27(17-24)33(18-30(38)37-40)20-32(2,3)36-29(33)16-22-9-5-4-6-10-22/h4-15,17,29,36,40H,16,18-20H2,1-3H3,(H2,34,39)(H,37,38) |
| InChIKey | ABNZOKMXQGPBDI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|