C26H35N5O — CID 173226016
4-N-[3-(2-methylpiperidin-1-yl)propyl]-6-(6-phenylmethoxycyclohexa-1,5-dien-1-yl)pyrimidine-2,4-diamine (PubChem CID 173226016) has the molecular formula C26H35N5O and a molecular weight of 433.60 g/mol. Its IUPAC name is 4-N-[3-(2-methylpiperidin-1-yl)propyl]-6-(6-phenylmethoxycyclohexa-1,5-dien-1-yl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(2-methylpiperidin-1-yl)propyl]-6-(6-phenylmethoxycyclohexa-1,5-dien-1-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 173226016 |
| Molecular Formula | C26H35N5O |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | 4-N-[3-(2-methylpiperidin-1-yl)propyl]-6-(6-phenylmethoxycyclohexa-1,5-dien-1-yl)pyrimidine-2,4-diamine |
| SMILES | CC1CCCCN1CCCNc1cc(C2=CCCC=C2OCc2ccccc2)nc(N)n1 |
| InChI | InChI=1S/C26H35N5O/c1-20-10-7-8-16-31(20)17-9-15-28-25-18-23(29-26(27)30-25)22-13-5-6-14-24(22)32-19-21-11-3-2-4-12-21/h2-4,11-14,18,20H,5-10,15-17,19H2,1H3,(H3,27,28,29,30) |
| InChIKey | QUIQKPSRHKPUAJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|