C7H14 — CID 173226872
1,2,2,3-tetradeuterio-1-methylcyclohexane (PubChem CID 173226872) has the molecular formula C7H14 and a molecular weight of 102.21 g/mol. Its IUPAC name is 1,2,2,3-tetradeuterio-1-methylcyclohexane.
| Compound Name | 1,2,2,3-tetradeuterio-1-methylcyclohexane |
|---|---|
| PubChem CID | 173226872 |
| Molecular Formula | C7H14 |
| Molecular Weight | 102.21 g/mol |
| Exact Mass | 102.13 |
| IUPAC Name | 1,2,2,3-tetradeuterio-1-methylcyclohexane |
| SMILES | [2H]C1CCCC([2H])(C)C1([2H])[2H] |
| InChI | InChI=1S/C7H14/c1-7-5-3-2-4-6-7/h7H,2-6H2,1H3/i3D,5D2,7D |
| InChIKey | UAEPNZWRGJTJPN-RIBCBKQJSA-N |
| XLogP | 2.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |