C26H22Zr — CID 173229524
2-methyl-1H-inden-1-ide;4-phenylbuta-1,3-dienylbenzene;zirconium(2+) (PubChem CID 173229524) has the molecular formula C26H22Zr and a molecular weight of 425.69 g/mol. Its IUPAC name is 2-methyl-1H-inden-1-ide;4-phenylbuta-1,3-dienylbenzene;zirconium(2+).
| Compound Name | 2-methyl-1H-inden-1-ide;4-phenylbuta-1,3-dienylbenzene;zirconium(2+) |
|---|---|
| PubChem CID | 173229524 |
| Molecular Formula | C26H22Zr |
| Molecular Weight | 425.69 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 2-methyl-1H-inden-1-ide;4-phenylbuta-1,3-dienylbenzene;zirconium(2+) |
| SMILES | Cc1cc2ccccc2[cH-]1.[C-](=C\C=Cc1ccccc1)\c1ccccc1.[Zr+2] |
| InChI | InChI=1S/C16H13.C10H9.Zr/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16;1-8-6-9-4-2-3-5-10(9)7-8;/h1-13H;2-7H,1H3;/q2*-1;+2 |
| InChIKey | SHISZXAYLAZSHG-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.69 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|