C41H43Zr- — CID 173229691
benzhydrylidenezirconium;2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-3-ethyl-9H-fluoren-9-ide (PubChem CID 173229691) has the molecular formula C41H43Zr- and a molecular weight of 627.02 g/mol. Its IUPAC name is benzhydrylidenezirconium;2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-3-ethyl-9H-fluoren-9-ide.
| Compound Name | benzhydrylidenezirconium;2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-3-ethyl-9H-fluoren-9-ide |
|---|---|
| PubChem CID | 173229691 |
| Molecular Formula | C41H43Zr- |
| Molecular Weight | 627.02 g/mol |
| Exact Mass | 625.24 |
| IUPAC Name | benzhydrylidenezirconium;2,7-ditert-butyl-1-cyclopenta-1,3-dien-1-yl-3-ethyl-9H-fluoren-9-ide |
| SMILES | CCc1cc2c([cH-]c3cc(C(C)(C)C)ccc32)c(C2=CC=CC2)c1C(C)(C)C.[Zr]=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33.C13H10.Zr/c1-8-18-16-23-22-14-13-21(27(2,3)4)15-20(22)17-24(23)25(19-11-9-10-12-19)26(18)28(5,6)7;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h9-11,13-17H,8,12H2,1-7H3;1-10H;/q-1;; |
| InChIKey | YDDUUXLYQKIULI-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.02 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|