C21H26N4O8S — CID 173232264
but-2-enedioic acid;2-[(2,3-dimethoxybenzoyl)amino]-N-[2-(dimethylamino)ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 173232264) has the molecular formula C21H26N4O8S and a molecular weight of 494.53 g/mol. Its IUPAC name is but-2-enedioic acid;2-[(2,3-dimethoxybenzoyl)amino]-N-[2-(dimethylamino)ethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | but-2-enedioic acid;2-[(2,3-dimethoxybenzoyl)amino]-N-[2-(dimethylamino)ethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 173232264 |
| Molecular Formula | C21H26N4O8S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | but-2-enedioic acid;2-[(2,3-dimethoxybenzoyl)amino]-N-[2-(dimethylamino)ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | COc1cccc(C(=O)Nc2nc(C(=O)NCCN(C)C)cs2)c1OC.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C17H22N4O4S.C4H4O4/c1-21(2)9-8-18-16(23)12-10-26-17(19-12)20-15(22)11-6-5-7-13(24-3)14(11)25-4;5-3(6)1-2-4(7)8/h5-7,10H,8-9H2,1-4H3,(H,18,23)(H,19,20,22);1-2H,(H,5,6)(H,7,8) |
| InChIKey | KQEKWAZIMJNUES-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 167.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|