C46H46 — CID 173235726
1,2,3,4,8,9,10,11-octakis(prop-2-enyl)pentacene (PubChem CID 173235726) has the molecular formula C46H46 and a molecular weight of 598.87 g/mol. Its IUPAC name is 1,2,3,4,8,9,10,11-octakis(prop-2-enyl)pentacene.
| Compound Name | 1,2,3,4,8,9,10,11-octakis(prop-2-enyl)pentacene |
|---|---|
| PubChem CID | 173235726 |
| Molecular Formula | C46H46 |
| Molecular Weight | 598.87 g/mol |
| Exact Mass | 598.36 |
| IUPAC Name | 1,2,3,4,8,9,10,11-octakis(prop-2-enyl)pentacene |
| SMILES | C=CCc1c(CC=C)c(CC=C)c2cc3cc4cc5c(CC=C)c(CC=C)c(CC=C)c(CC=C)c5cc4cc3cc2c1CC=C |
| InChI | InChI=1S/C46H46/c1-9-17-35-36(18-10-2)40(22-14-6)44-28-32-26-34-30-46-42(24-16-8)38(20-12-4)37(19-11-3)41(23-15-7)45(46)29-33(34)25-31(32)27-43(44)39(35)21-13-5/h9-16,25-30H,1-8,17-24H2 |
| InChIKey | PWZYMASIYJHPKN-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.87 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|