C21H22ClNO6S — CID 173238663
2-[[1-[3-(2-chlorophenyl)prop-2-enoyl]-5-methoxy-2,3-dihydroindol-6-yl]oxy]ethyl methanesulfonate (PubChem CID 173238663) has the molecular formula C21H22ClNO6S and a molecular weight of 451.93 g/mol. Its IUPAC name is 2-[[1-[3-(2-chlorophenyl)prop-2-enoyl]-5-methoxy-2,3-dihydroindol-6-yl]oxy]ethyl methanesulfonate.
| Compound Name | 2-[[1-[3-(2-chlorophenyl)prop-2-enoyl]-5-methoxy-2,3-dihydroindol-6-yl]oxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 173238663 |
| Molecular Formula | C21H22ClNO6S |
| Molecular Weight | 451.93 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 2-[[1-[3-(2-chlorophenyl)prop-2-enoyl]-5-methoxy-2,3-dihydroindol-6-yl]oxy]ethyl methanesulfonate |
| SMILES | COc1cc2c(cc1OCCOS(C)(=O)=O)N(C(=O)C=Cc1ccccc1Cl)CC2 |
| InChI | InChI=1S/C21H22ClNO6S/c1-27-19-13-16-9-10-23(21(24)8-7-15-5-3-4-6-17(15)22)18(16)14-20(19)28-11-12-29-30(2,25)26/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | HWKAKMGENMUKLI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.93 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|