C10H9NO2 — CID 173249209
1-(1,2-oxazol-3-yl)cyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 173249209) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 1-(1,2-oxazol-3-yl)cyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 1-(1,2-oxazol-3-yl)cyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 173249209 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 1-(1,2-oxazol-3-yl)cyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | O=CC1(c2ccon2)C=CC=CC1 |
| InChI | InChI=1S/C10H9NO2/c12-8-10(5-2-1-3-6-10)9-4-7-13-11-9/h1-5,7-8H,6H2 |
| InChIKey | DLKGEYQOJFDJDT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|