C22H26N2O5 — CID 173249489
tert-butyl N-[(3S)-3-[4-(2-amino-2-oxoethoxy)phenyl]-2-oxo-3-phenylpropyl]carbamate (PubChem CID 173249489) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is tert-butyl N-[(3S)-3-[4-(2-amino-2-oxoethoxy)phenyl]-2-oxo-3-phenylpropyl]carbamate.
| Compound Name | tert-butyl N-[(3S)-3-[4-(2-amino-2-oxoethoxy)phenyl]-2-oxo-3-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 173249489 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | tert-butyl N-[(3S)-3-[4-(2-amino-2-oxoethoxy)phenyl]-2-oxo-3-phenylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)[C@@H](c1ccccc1)c1ccc(OCC(N)=O)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-22(2,3)29-21(27)24-13-18(25)20(15-7-5-4-6-8-15)16-9-11-17(12-10-16)28-14-19(23)26/h4-12,20H,13-14H2,1-3H3,(H2,23,26)(H,24,27)/t20-/m0/s1 |
| InChIKey | DVOSEUDCMQCCSL-FQEVSTJZSA-N |
| XLogP | 2.78 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |