C12H12N4O2S2 — CID 173251191
1-(1-oxo-3-phenylpropan-2-yl)-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea (PubChem CID 173251191) has the molecular formula C12H12N4O2S2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 1-(1-oxo-3-phenylpropan-2-yl)-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea.
| Compound Name | 1-(1-oxo-3-phenylpropan-2-yl)-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea |
|---|---|
| PubChem CID | 173251191 |
| Molecular Formula | C12H12N4O2S2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 1-(1-oxo-3-phenylpropan-2-yl)-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea |
| SMILES | O=CC(Cc1ccccc1)NC(=O)Nc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C12H12N4O2S2/c17-7-9(6-8-4-2-1-3-5-8)13-10(18)14-11-15-16-12(19)20-11/h1-5,7,9H,6H2,(H,16,19)(H2,13,14,15,18) |
| InChIKey | GUAAPMXZCSSTSQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|