C11H16N2O — CID 173252398
4-(3,5-dimethyl-4-pyridinyl)butanamide (PubChem CID 173252398) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 4-(3,5-dimethyl-4-pyridinyl)butanamide.
| Compound Name | 4-(3,5-dimethyl-4-pyridinyl)butanamide |
|---|---|
| PubChem CID | 173252398 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 4-(3,5-dimethyl-4-pyridinyl)butanamide |
| SMILES | Cc1cncc(C)c1CCCC(N)=O |
| InChI | InChI=1S/C11H16N2O/c1-8-6-13-7-9(2)10(8)4-3-5-11(12)14/h6-7H,3-5H2,1-2H3,(H2,12,14) |
| InChIKey | QUSDOFDYBSIFQB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |