C29H21V- — CID 173257937
(2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene;vanadium (PubChem CID 173257937) has the molecular formula C29H21V- and a molecular weight of 420.43 g/mol. Its IUPAC name is (2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene;vanadium.
| Compound Name | (2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene;vanadium |
|---|---|
| PubChem CID | 173257937 |
| Molecular Formula | C29H21V- |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | (2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene;vanadium |
| SMILES | [V].c1ccc(-c2[cH-]c(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H21.V/c1-5-13-22(14-6-1)26-21-27(23-15-7-2-8-16-23)29(25-19-11-4-12-20-25)28(26)24-17-9-3-10-18-24;/h1-21H;/q-1; |
| InChIKey | YNRIWHVXZTYBJH-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|