About hydroxy(oxo)phosphanium;hydroxy-oxo-prop-2-enylphosphanium
hydroxy(oxo)phosphanium;hydroxy-oxo-prop-2-enylphosphanium (PubChem CID 173258446) has the molecular formula C3H8O4P2+2
and a molecular weight of 170.04 g/mol. Its IUPAC name is hydroxy(oxo)phosphanium;hydroxy-oxo-prop-2-enylphosphanium.
Molecular Properties
| Compound Name | hydroxy(oxo)phosphanium;hydroxy-oxo-prop-2-enylphosphanium |
| PubChem CID | 173258446 |
| Molecular Formula | C3H8O4P2+2 |
| Molecular Weight | 170.04 g/mol |
| Exact Mass | 169.99 |
| IUPAC Name | hydroxy(oxo)phosphanium;hydroxy-oxo-prop-2-enylphosphanium |
| SMILES | C=CC[P+](=O)O.O=[PH+]O |
| InChI | InChI=1S/C3H5O2P.HO2P/c1-2-3-6(4)5;1-3-2/h2H,1,3H2;3H/p+2 |
| InChIKey | MGBDALXPNDHSBQ-UHFFFAOYSA-P |
| XLogP | 0.82 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.04 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy(oxo)phosphanium;hydroxy-oxo-prop-2-enylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy(oxo)phosphanium;hydroxy-oxo-prop-2-enylphosphanium?
The IUPAC name of hydroxy(oxo)phosphanium;hydroxy-oxo-prop-2-enylphosphanium (CID 173258446) is hydroxy(oxo)phosphanium;hydroxy-oxo-prop-2-enylphosphanium.
What is the SMILES notation for hydroxy(oxo)phosphanium;hydroxy-oxo-prop-2-enylphosphanium?
The canonical SMILES for hydroxy(oxo)phosphanium;hydroxy-oxo-prop-2-enylphosphanium is C=CC[P+](=O)O.O=[PH+]O.
What is the InChIKey of hydroxy(oxo)phosphanium;hydroxy-oxo-prop-2-enylphosphanium?
The InChIKey is MGBDALXPNDHSBQ-UHFFFAOYSA-P. The full InChI is InChI=1S/C3H5O2P.HO2P/c1-2-3-6(4)5;1-3-2/h2H,1,3H2;3H/p+2.
What are the key properties of hydroxy(oxo)phosphanium;hydroxy-oxo-prop-2-enylphosphanium?
hydroxy(oxo)phosphanium;hydroxy-oxo-prop-2-enylphosphanium has a molecular weight of 170.04 g/mol, XLogP of 0.82, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy(oxo)phosphanium;hydroxy-oxo-prop-2-enylphosphanium is sourced from PubChem (CID 173258446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).