About dichlorozirconium;2-(7-methyl-2-phenyl-1H-inden-1-id-4-yl)pyridine
dichlorozirconium;2-(7-methyl-2-phenyl-1H-inden-1-id-4-yl)pyridine (PubChem CID 173259468) has the molecular formula C21H16Cl2NZr-
and a molecular weight of 444.50 g/mol. Its IUPAC name is dichlorozirconium;2-(7-methyl-2-phenyl-1H-inden-1-id-4-yl)pyridine.
Molecular Properties
| Compound Name | dichlorozirconium;2-(7-methyl-2-phenyl-1H-inden-1-id-4-yl)pyridine |
| PubChem CID | 173259468 |
| Molecular Formula | C21H16Cl2NZr- |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 441.97 |
| IUPAC Name | dichlorozirconium;2-(7-methyl-2-phenyl-1H-inden-1-id-4-yl)pyridine |
| SMILES | Cc1ccc(-c2ccccn2)c2cc(-c3ccccc3)[cH-]c12.Cl[Zr]Cl |
| InChI | InChI=1S/C21H16N.2ClH.Zr/c1-15-10-11-18(21-9-5-6-12-22-21)20-14-17(13-19(15)20)16-7-3-2-4-8-16;;;/h2-14H,1H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | SHFUKQZNBDEIGI-UHFFFAOYSA-L |
| XLogP | 6.97 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichlorozirconium;2-(7-methyl-2-phenyl-1H-inden-1-id-4-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium;2-(7-methyl-2-phenyl-1H-inden-1-id-4-yl)pyridine?
The IUPAC name of dichlorozirconium;2-(7-methyl-2-phenyl-1H-inden-1-id-4-yl)pyridine (CID 173259468) is dichlorozirconium;2-(7-methyl-2-phenyl-1H-inden-1-id-4-yl)pyridine.
What is the SMILES notation for dichlorozirconium;2-(7-methyl-2-phenyl-1H-inden-1-id-4-yl)pyridine?
The canonical SMILES for dichlorozirconium;2-(7-methyl-2-phenyl-1H-inden-1-id-4-yl)pyridine is Cc1ccc(-c2ccccn2)c2cc(-c3ccccc3)[cH-]c12.Cl[Zr]Cl.
What is the InChIKey of dichlorozirconium;2-(7-methyl-2-phenyl-1H-inden-1-id-4-yl)pyridine?
The InChIKey is SHFUKQZNBDEIGI-UHFFFAOYSA-L. The full InChI is InChI=1S/C21H16N.2ClH.Zr/c1-15-10-11-18(21-9-5-6-12-22-21)20-14-17(13-19(15)20)16-7-3-2-4-8-16;;;/h2-14H,1H3;2*1H;/q-1;;;+2/p-2.
What are the key properties of dichlorozirconium;2-(7-methyl-2-phenyl-1H-inden-1-id-4-yl)pyridine?
dichlorozirconium;2-(7-methyl-2-phenyl-1H-inden-1-id-4-yl)pyridine has a molecular weight of 444.50 g/mol, XLogP of 6.97, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium;2-(7-methyl-2-phenyl-1H-inden-1-id-4-yl)pyridine is sourced from PubChem (CID 173259468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).