C19H19Zr- — CID 174373045
4,5,6,7-tetramethyl-2-phenyl-1H-inden-1-ide;zirconium (PubChem CID 174373045) has the molecular formula C19H19Zr- and a molecular weight of 338.58 g/mol. Its IUPAC name is 4,5,6,7-tetramethyl-2-phenyl-1H-inden-1-ide;zirconium.
| Compound Name | 4,5,6,7-tetramethyl-2-phenyl-1H-inden-1-ide;zirconium |
|---|---|
| PubChem CID | 174373045 |
| Molecular Formula | C19H19Zr- |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 4,5,6,7-tetramethyl-2-phenyl-1H-inden-1-ide;zirconium |
| SMILES | Cc1c(C)c(C)c2[cH-]c(-c3ccccc3)cc2c1C.[Zr] |
| InChI | InChI=1S/C19H19.Zr/c1-12-13(2)15(4)19-11-17(10-18(19)14(12)3)16-8-6-5-7-9-16;/h5-11H,1-4H3;/q-1; |
| InChIKey | YBWLHNKZIGTOEJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|