About 4,5,6,7-tetramethyl-2-phenyl-1H-inden-1-ide;zirconium
4,5,6,7-tetramethyl-2-phenyl-1H-inden-1-ide;zirconium (PubChem CID 174373045) has the molecular formula C19H19Zr-
and a molecular weight of 338.58 g/mol. Its IUPAC name is 4,5,6,7-tetramethyl-2-phenyl-1H-inden-1-ide;zirconium.
Molecular Properties
| Compound Name | 4,5,6,7-tetramethyl-2-phenyl-1H-inden-1-ide;zirconium |
| PubChem CID | 174373045 |
| Molecular Formula | C19H19Zr- |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 4,5,6,7-tetramethyl-2-phenyl-1H-inden-1-ide;zirconium |
| SMILES | Cc1c(C)c(C)c2[cH-]c(-c3ccccc3)cc2c1C.[Zr] |
| InChI | InChI=1S/C19H19.Zr/c1-12-13(2)15(4)19-11-17(10-18(19)14(12)3)16-8-6-5-7-9-16;/h5-11H,1-4H3;/q-1; |
| InChIKey | YBWLHNKZIGTOEJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4,5,6,7-tetramethyl-2-phenyl-1H-inden-1-ide;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6,7-tetramethyl-2-phenyl-1H-inden-1-ide;zirconium?
The IUPAC name of 4,5,6,7-tetramethyl-2-phenyl-1H-inden-1-ide;zirconium (CID 174373045) is 4,5,6,7-tetramethyl-2-phenyl-1H-inden-1-ide;zirconium.
What is the SMILES notation for 4,5,6,7-tetramethyl-2-phenyl-1H-inden-1-ide;zirconium?
The canonical SMILES for 4,5,6,7-tetramethyl-2-phenyl-1H-inden-1-ide;zirconium is Cc1c(C)c(C)c2[cH-]c(-c3ccccc3)cc2c1C.[Zr].
What is the InChIKey of 4,5,6,7-tetramethyl-2-phenyl-1H-inden-1-ide;zirconium?
The InChIKey is YBWLHNKZIGTOEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19.Zr/c1-12-13(2)15(4)19-11-17(10-18(19)14(12)3)16-8-6-5-7-9-16;/h5-11H,1-4H3;/q-1;.
What are the key properties of 4,5,6,7-tetramethyl-2-phenyl-1H-inden-1-ide;zirconium?
4,5,6,7-tetramethyl-2-phenyl-1H-inden-1-ide;zirconium has a molecular weight of 338.58 g/mol, XLogP of 5.46, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6,7-tetramethyl-2-phenyl-1H-inden-1-ide;zirconium is sourced from PubChem (CID 174373045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).