C32H26 — CID 176589325
1,2,4,5-tetrakis(2-deuteriophenyl)-3,6-dimethylbenzene (PubChem CID 176589325) has the molecular formula C32H26 and a molecular weight of 414.58 g/mol. Its IUPAC name is 1,2,4,5-tetrakis(2-deuteriophenyl)-3,6-dimethylbenzene.
| Compound Name | 1,2,4,5-tetrakis(2-deuteriophenyl)-3,6-dimethylbenzene |
|---|---|
| PubChem CID | 176589325 |
| Molecular Formula | C32H26 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 1,2,4,5-tetrakis(2-deuteriophenyl)-3,6-dimethylbenzene |
| SMILES | [2H]c1ccccc1-c1c(C)c(-c2ccccc2[2H])c(-c2ccccc2[2H])c(C)c1-c1ccccc1[2H] |
| InChI | InChI=1S/C32H26/c1-23-29(25-15-7-3-8-16-25)31(27-19-11-5-12-20-27)24(2)32(28-21-13-6-14-22-28)30(23)26-17-9-4-10-18-26/h3-22H,1-2H3/i15D,17D,19D,21D |
| InChIKey | DALUSGMSSXODQU-AEQKFDLZSA-N |
| XLogP | 8.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |