C31H26BrF2O3P — CID 173263922
[3-[(E)-2-benzoyl-2,5-diphenylpent-4-enyl]-2-bromophenyl]-(difluoromethyl)phosphinic acid (PubChem CID 173263922) has the molecular formula C31H26BrF2O3P and a molecular weight of 595.42 g/mol. Its IUPAC name is [3-[(E)-2-benzoyl-2,5-diphenylpent-4-enyl]-2-bromophenyl]-(difluoromethyl)phosphinic acid.
| Compound Name | [3-[(E)-2-benzoyl-2,5-diphenylpent-4-enyl]-2-bromophenyl]-(difluoromethyl)phosphinic acid |
|---|---|
| PubChem CID | 173263922 |
| Molecular Formula | C31H26BrF2O3P |
| Molecular Weight | 595.42 g/mol |
| Exact Mass | 594.08 |
| IUPAC Name | [3-[(E)-2-benzoyl-2,5-diphenylpent-4-enyl]-2-bromophenyl]-(difluoromethyl)phosphinic acid |
| SMILES | O=C(c1ccccc1)C(C/C=C/c1ccccc1)(Cc1cccc(P(=O)(O)C(F)F)c1Br)c1ccccc1 |
| InChI | InChI=1S/C31H26BrF2O3P/c32-28-25(17-10-20-27(28)38(36,37)30(33)34)22-31(26-18-8-3-9-19-26,29(35)24-15-6-2-7-16-24)21-11-14-23-12-4-1-5-13-23/h1-20,30H,21-22H2,(H,36,37)/b14-11+ |
| InChIKey | AKZZLOZVFAENBB-SDNWHVSQSA-N |
| XLogP | 8.03 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.42 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|