About 1-octoxypropylarsane
1-octoxypropylarsane (PubChem CID 173268691) has the molecular formula C11H25AsO
and a molecular weight of 248.24 g/mol. Its IUPAC name is 1-octoxypropylarsane.
Molecular Properties
| Compound Name | 1-octoxypropylarsane |
| PubChem CID | 173268691 |
| Molecular Formula | C11H25AsO |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 1-octoxypropylarsane |
| SMILES | CCCCCCCCOC([AsH2])CC |
| InChI | InChI=1S/C11H25AsO/c1-3-5-6-7-8-9-10-13-11(12)4-2/h11H,3-10,12H2,1-2H3 |
| InChIKey | MQLGRGJUELJJKO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-octoxypropylarsane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-octoxypropylarsane?
The IUPAC name of 1-octoxypropylarsane (CID 173268691) is 1-octoxypropylarsane.
What is the SMILES notation for 1-octoxypropylarsane?
The canonical SMILES for 1-octoxypropylarsane is CCCCCCCCOC([AsH2])CC.
What is the InChIKey of 1-octoxypropylarsane?
The InChIKey is MQLGRGJUELJJKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25AsO/c1-3-5-6-7-8-9-10-13-11(12)4-2/h11H,3-10,12H2,1-2H3.
What are the key properties of 1-octoxypropylarsane?
1-octoxypropylarsane has a molecular weight of 248.24 g/mol, XLogP of 2.73, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-octoxypropylarsane is sourced from PubChem (CID 173268691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).