About 1-hexoxypropylsilane
1-hexoxypropylsilane (PubChem CID 174351834) has the molecular formula C9H22OSi
and a molecular weight of 174.36 g/mol. Its IUPAC name is 1-hexoxypropylsilane.
Molecular Properties
| Compound Name | 1-hexoxypropylsilane |
| PubChem CID | 174351834 |
| Molecular Formula | C9H22OSi |
| Molecular Weight | 174.36 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 1-hexoxypropylsilane |
| SMILES | CCCCCCOC([SiH3])CC |
| InChI | InChI=1S/C9H22OSi/c1-3-5-6-7-8-10-9(11)4-2/h9H,3-8H2,1-2,11H3 |
| InChIKey | YHNBOMKFNANIRQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-hexoxypropylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexoxypropylsilane?
The IUPAC name of 1-hexoxypropylsilane (CID 174351834) is 1-hexoxypropylsilane.
What is the SMILES notation for 1-hexoxypropylsilane?
The canonical SMILES for 1-hexoxypropylsilane is CCCCCCOC([SiH3])CC.
What is the InChIKey of 1-hexoxypropylsilane?
The InChIKey is YHNBOMKFNANIRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22OSi/c1-3-5-6-7-8-10-9(11)4-2/h9H,3-8H2,1-2,11H3.
What are the key properties of 1-hexoxypropylsilane?
1-hexoxypropylsilane has a molecular weight of 174.36 g/mol, XLogP of 1.68, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexoxypropylsilane is sourced from PubChem (CID 174351834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).