C29H34O3S — CID 173271196
4-methyl-2-[11-(3,4,5-trimethoxyphenyl)undeca-4,6,10-trienyl]-1-benzothiophene (PubChem CID 173271196) has the molecular formula C29H34O3S and a molecular weight of 462.66 g/mol. Its IUPAC name is 4-methyl-2-[11-(3,4,5-trimethoxyphenyl)undeca-4,6,10-trienyl]-1-benzothiophene.
| Compound Name | 4-methyl-2-[11-(3,4,5-trimethoxyphenyl)undeca-4,6,10-trienyl]-1-benzothiophene |
|---|---|
| PubChem CID | 173271196 |
| Molecular Formula | C29H34O3S |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 4-methyl-2-[11-(3,4,5-trimethoxyphenyl)undeca-4,6,10-trienyl]-1-benzothiophene |
| SMILES | COc1cc(C=CCCC=CC=CCCCc2cc3c(C)cccc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C29H34O3S/c1-22-15-14-18-28-25(22)21-24(33-28)17-13-11-9-7-5-6-8-10-12-16-23-19-26(30-2)29(32-4)27(20-23)31-3/h5-7,9,12,14-16,18-21H,8,10-11,13,17H2,1-4H3 |
| InChIKey | IBHNLPUKQKDSLO-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|