About 2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium
2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium (PubChem CID 173274217) has the molecular formula C10H13NO5P+
and a molecular weight of 258.19 g/mol. Its IUPAC name is 2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium.
Molecular Properties
| Compound Name | 2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium |
| PubChem CID | 173274217 |
| Molecular Formula | C10H13NO5P+ |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium |
| SMILES | O=[N+]([O-])c1ccc(C[P+]2(O)OCCCO2)cc1 |
| InChI | InChI=1S/C10H13NO5P/c12-11(13)10-4-2-9(3-5-10)8-17(14)15-6-1-7-16-17/h2-5,14H,1,6-8H2/q+1 |
| InChIKey | VFXWHBXKRJKSLD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium?
The IUPAC name of 2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium (CID 173274217) is 2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium.
What is the SMILES notation for 2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium?
The canonical SMILES for 2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium is O=[N+]([O-])c1ccc(C[P+]2(O)OCCCO2)cc1.
What is the InChIKey of 2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium?
The InChIKey is VFXWHBXKRJKSLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO5P/c12-11(13)10-4-2-9(3-5-10)8-17(14)15-6-1-7-16-17/h2-5,14H,1,6-8H2/q+1.
What are the key properties of 2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium?
2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium has a molecular weight of 258.19 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium is sourced from PubChem (CID 173274217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).