C10H13NO5P+ — CID 173274217
2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium (PubChem CID 173274217) has the molecular formula C10H13NO5P+ and a molecular weight of 258.19 g/mol. Its IUPAC name is 2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium.
| Compound Name | 2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium |
|---|---|
| PubChem CID | 173274217 |
| Molecular Formula | C10H13NO5P+ |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium |
| SMILES | O=[N+]([O-])c1ccc(C[P+]2(O)OCCCO2)cc1 |
| InChI | InChI=1S/C10H13NO5P/c12-11(13)10-4-2-9(3-5-10)8-17(14)15-6-1-7-16-17/h2-5,14H,1,6-8H2/q+1 |
| InChIKey | VFXWHBXKRJKSLD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|