C14H21NO5P+ — CID 173274219
5,5-diethyl-2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium (PubChem CID 173274219) has the molecular formula C14H21NO5P+ and a molecular weight of 314.30 g/mol. Its IUPAC name is 5,5-diethyl-2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium.
| Compound Name | 5,5-diethyl-2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium |
|---|---|
| PubChem CID | 173274219 |
| Molecular Formula | C14H21NO5P+ |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 5,5-diethyl-2-hydroxy-2-[(4-nitrophenyl)methyl]-1,3,2-dioxaphosphinan-2-ium |
| SMILES | CCC1(CC)CO[P+](O)(Cc2ccc([N+](=O)[O-])cc2)OC1 |
| InChI | InChI=1S/C14H21NO5P/c1-3-14(4-2)10-19-21(18,20-11-14)9-12-5-7-13(8-6-12)15(16)17/h5-8,18H,3-4,9-11H2,1-2H3/q+1 |
| InChIKey | VWTDFSQVXLXCLC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|