C9H18O2Si — CID 173274643
silyl 2,2,5-trimethylhex-5-enoate (PubChem CID 173274643) has the molecular formula C9H18O2Si and a molecular weight of 186.33 g/mol. Its IUPAC name is silyl 2,2,5-trimethylhex-5-enoate.
| Compound Name | silyl 2,2,5-trimethylhex-5-enoate |
|---|---|
| PubChem CID | 173274643 |
| Molecular Formula | C9H18O2Si |
| Molecular Weight | 186.33 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | silyl 2,2,5-trimethylhex-5-enoate |
| SMILES | C=C(C)CCC(C)(C)C(=O)O[SiH3] |
| InChI | InChI=1S/C9H18O2Si/c1-7(2)5-6-9(3,4)8(10)11-12/h1,5-6H2,2-4,12H3 |
| InChIKey | JJYOXAQGGCDIAX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|