C16H30O4 — CID 173275497
9,10-dihydroxyhexadec-9-enoic acid (PubChem CID 173275497) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is 9,10-dihydroxyhexadec-9-enoic acid.
| Compound Name | 9,10-dihydroxyhexadec-9-enoic acid |
|---|---|
| PubChem CID | 173275497 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 9,10-dihydroxyhexadec-9-enoic acid |
| SMILES | CCCCCCC(O)=C(O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C16H30O4/c1-2-3-4-8-11-14(17)15(18)12-9-6-5-7-10-13-16(19)20/h17-18H,2-13H2,1H3,(H,19,20) |
| InChIKey | RZSJRWVZGIXHJP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|