C19H25Zr- — CID 173279670
3-tert-butyl-1H-inden-1-ide;2,3-dimethylbuta-1,3-diene;zirconium (PubChem CID 173279670) has the molecular formula C19H25Zr- and a molecular weight of 344.63 g/mol. Its IUPAC name is 3-tert-butyl-1H-inden-1-ide;2,3-dimethylbuta-1,3-diene;zirconium.
| Compound Name | 3-tert-butyl-1H-inden-1-ide;2,3-dimethylbuta-1,3-diene;zirconium |
|---|---|
| PubChem CID | 173279670 |
| Molecular Formula | C19H25Zr- |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 3-tert-butyl-1H-inden-1-ide;2,3-dimethylbuta-1,3-diene;zirconium |
| SMILES | C=C(C)C(=C)C.CC(C)(C)c1c[cH-]c2ccccc12.[Zr] |
| InChI | InChI=1S/C13H15.C6H10.Zr/c1-13(2,3)12-9-8-10-6-4-5-7-11(10)12;1-5(2)6(3)4;/h4-9H,1-3H3;1,3H2,2,4H3;/q-1;; |
| InChIKey | WBULZXMGIWYZLU-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|