C13H17N — CID 173281041
(2E,4Z,7Z)-6-ethylidene-2,5-dimethylnona-2,4,7-trienenitrile (PubChem CID 173281041) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (2E,4Z,7Z)-6-ethylidene-2,5-dimethylnona-2,4,7-trienenitrile.
| Compound Name | (2E,4Z,7Z)-6-ethylidene-2,5-dimethylnona-2,4,7-trienenitrile |
|---|---|
| PubChem CID | 173281041 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (2E,4Z,7Z)-6-ethylidene-2,5-dimethylnona-2,4,7-trienenitrile |
| SMILES | CC=C(/C=C\C)/C(C)=C\C=C(/C)C#N |
| InChI | InChI=1S/C13H17N/c1-5-7-13(6-2)12(4)9-8-11(3)10-14/h5-9H,1-4H3/b7-5-,11-8+,12-9-,13-6? |
| InChIKey | ULXMVXFDTNIUBR-WPCZLBMZSA-N |
| XLogP | 3.92 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|