C18H16Cl2N2O5S2 — CID 173282803
methyl 4-[[[4-chloro-3-(2-chloro-3-ethoxy-3-oxoprop-1-enyl)phenyl]-sulfanylcarbamoyl]amino]thiophene-3-carboxylate (PubChem CID 173282803) has the molecular formula C18H16Cl2N2O5S2 and a molecular weight of 475.38 g/mol. Its IUPAC name is methyl 4-[[[4-chloro-3-(2-chloro-3-ethoxy-3-oxoprop-1-enyl)phenyl]-sulfanylcarbamoyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-[[[4-chloro-3-(2-chloro-3-ethoxy-3-oxoprop-1-enyl)phenyl]-sulfanylcarbamoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 173282803 |
| Molecular Formula | C18H16Cl2N2O5S2 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 473.99 |
| IUPAC Name | methyl 4-[[[4-chloro-3-(2-chloro-3-ethoxy-3-oxoprop-1-enyl)phenyl]-sulfanylcarbamoyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)C(Cl)=Cc1cc(N(S)C(=O)Nc2cscc2C(=O)OC)ccc1Cl |
| InChI | InChI=1S/C18H16Cl2N2O5S2/c1-3-27-17(24)14(20)7-10-6-11(4-5-13(10)19)22(28)18(25)21-15-9-29-8-12(15)16(23)26-2/h4-9,28H,3H2,1-2H3,(H,21,25) |
| InChIKey | XSWCUOKZDSWRJS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|