C5H13N3S — CID 173289067
2,3,4-trimethyl-1-sulfanyl-1,2,4-triazolidine (PubChem CID 173289067) has the molecular formula C5H13N3S and a molecular weight of 147.25 g/mol. Its IUPAC name is 2,3,4-trimethyl-1-sulfanyl-1,2,4-triazolidine.
| Compound Name | 2,3,4-trimethyl-1-sulfanyl-1,2,4-triazolidine |
|---|---|
| PubChem CID | 173289067 |
| Molecular Formula | C5H13N3S |
| Molecular Weight | 147.25 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 2,3,4-trimethyl-1-sulfanyl-1,2,4-triazolidine |
| SMILES | CC1N(C)CN(S)N1C |
| InChI | InChI=1S/C5H13N3S/c1-5-6(2)4-8(9)7(5)3/h5,9H,4H2,1-3H3 |
| InChIKey | BDSUWKRGZQWWSG-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 9.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|