C12H9Cl2NOS — CID 173291560
4-(2,3-dichlorophenoxy)-2-methylsulfanylpyridine (PubChem CID 173291560) has the molecular formula C12H9Cl2NOS and a molecular weight of 286.18 g/mol. Its IUPAC name is 4-(2,3-dichlorophenoxy)-2-methylsulfanylpyridine.
| Compound Name | 4-(2,3-dichlorophenoxy)-2-methylsulfanylpyridine |
|---|---|
| PubChem CID | 173291560 |
| Molecular Formula | C12H9Cl2NOS |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 4-(2,3-dichlorophenoxy)-2-methylsulfanylpyridine |
| SMILES | CSc1cc(Oc2cccc(Cl)c2Cl)ccn1 |
| InChI | InChI=1S/C12H9Cl2NOS/c1-17-11-7-8(5-6-15-11)16-10-4-2-3-9(13)12(10)14/h2-7H,1H3 |
| InChIKey | BKUGSZNBQTYPPZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |