C8H21NO2Si2 — CID 173292919
3,3-bis(dimethylsilyl)propylcarbamic acid (PubChem CID 173292919) has the molecular formula C8H21NO2Si2 and a molecular weight of 219.43 g/mol. Its IUPAC name is 3,3-bis(dimethylsilyl)propylcarbamic acid.
| Compound Name | 3,3-bis(dimethylsilyl)propylcarbamic acid |
|---|---|
| PubChem CID | 173292919 |
| Molecular Formula | C8H21NO2Si2 |
| Molecular Weight | 219.43 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 3,3-bis(dimethylsilyl)propylcarbamic acid |
| SMILES | C[SiH](C)C(CCNC(=O)O)[SiH](C)C |
| InChI | InChI=1S/C8H21NO2Si2/c1-12(2)7(13(3)4)5-6-9-8(10)11/h7,9,12-13H,5-6H2,1-4H3,(H,10,11) |
| InChIKey | RGVIZEIEVGNHJB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|