C15H29NO5 — CID 173298296
ethyl 3-ethyl-2-hydroxy-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 173298296) has the molecular formula C15H29NO5 and a molecular weight of 303.40 g/mol. Its IUPAC name is ethyl 3-ethyl-2-hydroxy-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | ethyl 3-ethyl-2-hydroxy-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 173298296 |
| Molecular Formula | C15H29NO5 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | ethyl 3-ethyl-2-hydroxy-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CCOC(=O)C(C)(O)C(CC)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29NO5/c1-7-11(15(6,19)12(17)20-8-2)9-10-16-13(18)21-14(3,4)5/h11,19H,7-10H2,1-6H3,(H,16,18) |
| InChIKey | AMUXVJDFOOVRBO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |