C39H31N3O4S — CID 173304146
methyl 2-[(Z)-[2-oxo-1-[2-(tritylamino)-1,3-thiazol-4-yl]ethylidene]amino]oxy-2,2-diphenylacetate (PubChem CID 173304146) has the molecular formula C39H31N3O4S and a molecular weight of 637.76 g/mol. Its IUPAC name is methyl 2-[(Z)-[2-oxo-1-[2-(tritylamino)-1,3-thiazol-4-yl]ethylidene]amino]oxy-2,2-diphenylacetate.
| Compound Name | methyl 2-[(Z)-[2-oxo-1-[2-(tritylamino)-1,3-thiazol-4-yl]ethylidene]amino]oxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 173304146 |
| Molecular Formula | C39H31N3O4S |
| Molecular Weight | 637.76 g/mol |
| Exact Mass | 637.20 |
| IUPAC Name | methyl 2-[(Z)-[2-oxo-1-[2-(tritylamino)-1,3-thiazol-4-yl]ethylidene]amino]oxy-2,2-diphenylacetate |
| SMILES | COC(=O)C(O/N=C(\C=O)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H31N3O4S/c1-45-36(44)39(32-23-13-5-14-24-32,33-25-15-6-16-26-33)46-42-34(27-43)35-28-47-37(40-35)41-38(29-17-7-2-8-18-29,30-19-9-3-10-20-30)31-21-11-4-12-22-31/h2-28H,1H3,(H,40,41)/b42-34+ |
| InChIKey | VODNJSGQRWCAQG-GGGSGSEDSA-N |
| XLogP | 7.58 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.76 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|