C10H20O2 — CID 173308761
2,6-dimethyloct-1-ene-1,5-diol (PubChem CID 173308761) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is 2,6-dimethyloct-1-ene-1,5-diol.
| Compound Name | 2,6-dimethyloct-1-ene-1,5-diol |
|---|---|
| PubChem CID | 173308761 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 2,6-dimethyloct-1-ene-1,5-diol |
| SMILES | CCC(C)C(O)CCC(C)=CO |
| InChI | InChI=1S/C10H20O2/c1-4-9(3)10(12)6-5-8(2)7-11/h7,9-12H,4-6H2,1-3H3 |
| InChIKey | XZYZXNWSKQVCAT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|