C18H32O5P+ — CID 173310102
[(Z)-1-carboxy-4-(2,6,6-trimethylcyclohexen-1-yl)but-1-en-2-yl]oxy-diethoxyphosphanium (PubChem CID 173310102) has the molecular formula C18H32O5P+ and a molecular weight of 359.42 g/mol. Its IUPAC name is [(Z)-1-carboxy-4-(2,6,6-trimethylcyclohexen-1-yl)but-1-en-2-yl]oxy-diethoxyphosphanium.
| Compound Name | [(Z)-1-carboxy-4-(2,6,6-trimethylcyclohexen-1-yl)but-1-en-2-yl]oxy-diethoxyphosphanium |
|---|---|
| PubChem CID | 173310102 |
| Molecular Formula | C18H32O5P+ |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | [(Z)-1-carboxy-4-(2,6,6-trimethylcyclohexen-1-yl)but-1-en-2-yl]oxy-diethoxyphosphanium |
| SMILES | CCO[PH+](OCC)O/C(=C\C(=O)O)CCC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C18H31O5P/c1-6-21-24(22-7-2)23-15(13-17(19)20)10-11-16-14(3)9-8-12-18(16,4)5/h13,24H,6-12H2,1-5H3/p+1/b15-13- |
| InChIKey | KZRYQLNHMKONNH-SQFISAMPSA-O |
| XLogP | 5.31 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|