C24H32 — CID 173312164
(8R,9R,10S,11S,13S,14S)-13-methyl-11-phenyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 173312164) has the molecular formula C24H32 and a molecular weight of 320.52 g/mol. Its IUPAC name is (8R,9R,10S,11S,13S,14S)-13-methyl-11-phenyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | (8R,9R,10S,11S,13S,14S)-13-methyl-11-phenyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 173312164 |
| Molecular Formula | C24H32 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | (8R,9R,10S,11S,13S,14S)-13-methyl-11-phenyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3CC=CC[C@@H]3[C@H]1[C@@H](c1ccccc1)C2 |
| InChI | InChI=1S/C24H32/c1-24-15-7-12-22(24)20-14-13-18-10-5-6-11-19(18)23(20)21(16-24)17-8-3-2-4-9-17/h2-6,8-9,18-23H,7,10-16H2,1H3/t18?,19-,20-,21+,22-,23+,24-/m0/s1 |
| InChIKey | FFLKGTPVGDTNLE-LPOVECMESA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|