C17H14O14 — CID 173315508
2-[2-[(Z)-4-(3,4-dicarboxybut-3-enoyloxy)-3-methyl-4-oxobut-2-enoyl]oxy-2-oxoethyl]but-2-enedioic acid (PubChem CID 173315508) has the molecular formula C17H14O14 and a molecular weight of 442.29 g/mol. Its IUPAC name is 2-[2-[(Z)-4-(3,4-dicarboxybut-3-enoyloxy)-3-methyl-4-oxobut-2-enoyl]oxy-2-oxoethyl]but-2-enedioic acid.
| Compound Name | 2-[2-[(Z)-4-(3,4-dicarboxybut-3-enoyloxy)-3-methyl-4-oxobut-2-enoyl]oxy-2-oxoethyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 173315508 |
| Molecular Formula | C17H14O14 |
| Molecular Weight | 442.29 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 2-[2-[(Z)-4-(3,4-dicarboxybut-3-enoyloxy)-3-methyl-4-oxobut-2-enoyl]oxy-2-oxoethyl]but-2-enedioic acid |
| SMILES | C/C(=C/C(=O)OC(=O)CC(=CC(=O)O)C(=O)O)C(=O)OC(=O)CC(=CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H14O14/c1-7(17(29)31-14(24)6-9(16(27)28)4-11(20)21)2-12(22)30-13(23)5-8(15(25)26)3-10(18)19/h2-4H,5-6H2,1H3,(H,18,19)(H,20,21)(H,25,26)(H,27,28)/b7-2-,8-3?,9-4? |
| InChIKey | PSNYFSCTKRFHLQ-AIKNVHLNSA-N |
| XLogP | -0.96 |
| TPSA | 235.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.29 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|