About lithium;hydride;methyl(triphenyl)stannane
lithium;hydride;methyl(triphenyl)stannane (PubChem CID 173316313) has the molecular formula C19H19LiSn
and a molecular weight of 373.01 g/mol. Its IUPAC name is lithium;hydride;methyl(triphenyl)stannane.
Molecular Properties
| Compound Name | lithium;hydride;methyl(triphenyl)stannane |
| PubChem CID | 173316313 |
| Molecular Formula | C19H19LiSn |
| Molecular Weight | 373.01 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | lithium;hydride;methyl(triphenyl)stannane |
| SMILES | C[Sn](c1ccccc1)(c1ccccc1)c1ccccc1.[H-].[Li+] |
| InChI | InChI=1S/3C6H5.CH3.Li.Sn.H/c3*1-2-4-6-5-3-1;;;;/h3*1-5H;1H3;;;/q;;;;+1;;-1 |
| InChIKey | NLMVVTNPGHRIAZ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.01 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze lithium;hydride;methyl(triphenyl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;methyl(triphenyl)stannane?
The IUPAC name of lithium;hydride;methyl(triphenyl)stannane (CID 173316313) is lithium;hydride;methyl(triphenyl)stannane.
What is the SMILES notation for lithium;hydride;methyl(triphenyl)stannane?
The canonical SMILES for lithium;hydride;methyl(triphenyl)stannane is C[Sn](c1ccccc1)(c1ccccc1)c1ccccc1.[H-].[Li+].
What is the InChIKey of lithium;hydride;methyl(triphenyl)stannane?
The InChIKey is NLMVVTNPGHRIAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/3C6H5.CH3.Li.Sn.H/c3*1-2-4-6-5-3-1;;;;/h3*1-5H;1H3;;;/q;;;;+1;;-1.
What are the key properties of lithium;hydride;methyl(triphenyl)stannane?
lithium;hydride;methyl(triphenyl)stannane has a molecular weight of 373.01 g/mol, XLogP of -0.10, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;methyl(triphenyl)stannane is sourced from PubChem (CID 173316313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).