About dilithium;diphenylmethylbenzene;hydride
dilithium;diphenylmethylbenzene;hydride (PubChem CID 173115041) has the molecular formula C19H16Li2
and a molecular weight of 258.22 g/mol. Its IUPAC name is dilithium;diphenylmethylbenzene;hydride.
Molecular Properties
| Compound Name | dilithium;diphenylmethylbenzene;hydride |
| PubChem CID | 173115041 |
| Molecular Formula | C19H16Li2 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | dilithium;diphenylmethylbenzene;hydride |
| SMILES | [H-].[Li+].[Li+].c1ccc([C-](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15.2Li.H/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h1-15H;;;/q-1;2*+1;-1 |
| InChIKey | HTSOUTWTOXVJAR-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze dilithium;diphenylmethylbenzene;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;diphenylmethylbenzene;hydride?
The IUPAC name of dilithium;diphenylmethylbenzene;hydride (CID 173115041) is dilithium;diphenylmethylbenzene;hydride.
What is the SMILES notation for dilithium;diphenylmethylbenzene;hydride?
The canonical SMILES for dilithium;diphenylmethylbenzene;hydride is [H-].[Li+].[Li+].c1ccc([C-](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of dilithium;diphenylmethylbenzene;hydride?
The InChIKey is HTSOUTWTOXVJAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15.2Li.H/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h1-15H;;;/q-1;2*+1;-1.
What are the key properties of dilithium;diphenylmethylbenzene;hydride?
dilithium;diphenylmethylbenzene;hydride has a molecular weight of 258.22 g/mol, XLogP of -1.17, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;diphenylmethylbenzene;hydride is sourced from PubChem (CID 173115041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).