About dichlorotitanium;diphenylmethylbenzene
dichlorotitanium;diphenylmethylbenzene (PubChem CID 78065476) has the molecular formula C19H15Cl2Ti-
and a molecular weight of 362.10 g/mol. Its IUPAC name is dichlorotitanium;diphenylmethylbenzene.
Molecular Properties
| Compound Name | dichlorotitanium;diphenylmethylbenzene |
| PubChem CID | 78065476 |
| Molecular Formula | C19H15Cl2Ti- |
| Molecular Weight | 362.10 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | dichlorotitanium;diphenylmethylbenzene |
| SMILES | Cl[Ti]Cl.c1ccc([C-](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15.2ClH.Ti/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h1-15H;2*1H;/q-1;;;+2/p-2 |
| InChIKey | NANAYARMNWULNI-UHFFFAOYSA-L |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.10 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze dichlorotitanium;diphenylmethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorotitanium;diphenylmethylbenzene?
The IUPAC name of dichlorotitanium;diphenylmethylbenzene (CID 78065476) is dichlorotitanium;diphenylmethylbenzene.
What is the SMILES notation for dichlorotitanium;diphenylmethylbenzene?
The canonical SMILES for dichlorotitanium;diphenylmethylbenzene is Cl[Ti]Cl.c1ccc([C-](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of dichlorotitanium;diphenylmethylbenzene?
The InChIKey is NANAYARMNWULNI-UHFFFAOYSA-L. The full InChI is InChI=1S/C19H15.2ClH.Ti/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h1-15H;2*1H;/q-1;;;+2/p-2.
What are the key properties of dichlorotitanium;diphenylmethylbenzene?
dichlorotitanium;diphenylmethylbenzene has a molecular weight of 362.10 g/mol, XLogP of 6.08, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorotitanium;diphenylmethylbenzene is sourced from PubChem (CID 78065476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).