About 1-phenylethanamine
1-phenylethanamine (PubChem CID 59898296) has the molecular formula C8H10N-
and a molecular weight of 120.17 g/mol. Its IUPAC name is 1-phenylethanamine.
Molecular Properties
| Compound Name | 1-phenylethanamine |
| PubChem CID | 59898296 |
| Molecular Formula | C8H10N- |
| Molecular Weight | 120.17 g/mol |
| Exact Mass | 120.08 |
| IUPAC Name | 1-phenylethanamine |
| SMILES | C[C-](N)c1ccccc1 |
| InChI | InChI=1S/C8H10N/c1-7(9)8-5-3-2-4-6-8/h2-6H,9H2,1H3/q-1 |
| InChIKey | XNAKNZPQCDYFEW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.17 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethanamine?
The IUPAC name of 1-phenylethanamine (CID 59898296) is 1-phenylethanamine.
What is the SMILES notation for 1-phenylethanamine?
The canonical SMILES for 1-phenylethanamine is C[C-](N)c1ccccc1.
What is the InChIKey of 1-phenylethanamine?
The InChIKey is XNAKNZPQCDYFEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N/c1-7(9)8-5-3-2-4-6-8/h2-6H,9H2,1H3/q-1.
What are the key properties of 1-phenylethanamine?
1-phenylethanamine has a molecular weight of 120.17 g/mol, XLogP of 1.55, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethanamine is sourced from PubChem (CID 59898296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).