About dimethoxymethylbenzene;titanium
dimethoxymethylbenzene;titanium (PubChem CID 87292758) has the molecular formula C9H11O2Ti-
and a molecular weight of 199.05 g/mol. Its IUPAC name is dimethoxymethylbenzene;titanium.
Molecular Properties
| Compound Name | dimethoxymethylbenzene;titanium |
| PubChem CID | 87292758 |
| Molecular Formula | C9H11O2Ti- |
| Molecular Weight | 199.05 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | dimethoxymethylbenzene;titanium |
| SMILES | CO[C-](OC)c1ccccc1.[Ti] |
| InChI | InChI=1S/C9H11O2.Ti/c1-10-9(11-2)8-6-4-3-5-7-8;/h3-7H,1-2H3;/q-1; |
| InChIKey | DTAPNUOJSKSGST-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.05 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dimethoxymethylbenzene;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxymethylbenzene;titanium?
The IUPAC name of dimethoxymethylbenzene;titanium (CID 87292758) is dimethoxymethylbenzene;titanium.
What is the SMILES notation for dimethoxymethylbenzene;titanium?
The canonical SMILES for dimethoxymethylbenzene;titanium is CO[C-](OC)c1ccccc1.[Ti].
What is the InChIKey of dimethoxymethylbenzene;titanium?
The InChIKey is DTAPNUOJSKSGST-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O2.Ti/c1-10-9(11-2)8-6-4-3-5-7-8;/h3-7H,1-2H3;/q-1;.
What are the key properties of dimethoxymethylbenzene;titanium?
dimethoxymethylbenzene;titanium has a molecular weight of 199.05 g/mol, XLogP of 1.81, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxymethylbenzene;titanium is sourced from PubChem (CID 87292758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).