About sodium;diphenylmethylbenzene;sulfurous acid
sodium;diphenylmethylbenzene;sulfurous acid (PubChem CID 174649628) has the molecular formula C19H17NaO3S
and a molecular weight of 348.40 g/mol. Its IUPAC name is sodium;diphenylmethylbenzene;sulfurous acid.
Molecular Properties
| Compound Name | sodium;diphenylmethylbenzene;sulfurous acid |
| PubChem CID | 174649628 |
| Molecular Formula | C19H17NaO3S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | sodium;diphenylmethylbenzene;sulfurous acid |
| SMILES | O=S(O)O.[Na+].c1ccc([C-](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15.Na.H2O3S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;1-4(2)3/h1-15H;;(H2,1,2,3)/q-1;+1; |
| InChIKey | ZBTOAUXIAVSMNG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze sodium;diphenylmethylbenzene;sulfurous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;diphenylmethylbenzene;sulfurous acid?
The IUPAC name of sodium;diphenylmethylbenzene;sulfurous acid (CID 174649628) is sodium;diphenylmethylbenzene;sulfurous acid.
What is the SMILES notation for sodium;diphenylmethylbenzene;sulfurous acid?
The canonical SMILES for sodium;diphenylmethylbenzene;sulfurous acid is O=S(O)O.[Na+].c1ccc([C-](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of sodium;diphenylmethylbenzene;sulfurous acid?
The InChIKey is ZBTOAUXIAVSMNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15.Na.H2O3S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;1-4(2)3/h1-15H;;(H2,1,2,3)/q-1;+1;.
What are the key properties of sodium;diphenylmethylbenzene;sulfurous acid?
sodium;diphenylmethylbenzene;sulfurous acid has a molecular weight of 348.40 g/mol, XLogP of 1.39, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;diphenylmethylbenzene;sulfurous acid is sourced from PubChem (CID 174649628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).