C17H16Zr-2 — CID 173021155
di(cyclopenta-1,3-dien-1-yl)methylbenzene;hydride;zirconium (PubChem CID 173021155) has the molecular formula C17H16Zr-2 and a molecular weight of 311.54 g/mol. Its IUPAC name is di(cyclopenta-1,3-dien-1-yl)methylbenzene;hydride;zirconium.
| Compound Name | di(cyclopenta-1,3-dien-1-yl)methylbenzene;hydride;zirconium |
|---|---|
| PubChem CID | 173021155 |
| Molecular Formula | C17H16Zr-2 |
| Molecular Weight | 311.54 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | di(cyclopenta-1,3-dien-1-yl)methylbenzene;hydride;zirconium |
| SMILES | C1=CCC([C-](C2=CC=CC2)c2ccccc2)=C1.[H-].[Zr] |
| InChI | InChI=1S/C17H15.Zr.H/c1-2-8-14(9-3-1)17(15-10-4-5-11-15)16-12-6-7-13-16;;/h1-10,12H,11,13H2;;/q-1;;-1 |
| InChIKey | HSZNULFTBGAVPA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|