C23H30O3Zr — CID 173327045
di(cyclopenta-1,3-dien-1-yl)methylbenzene;ethanolate;zirconium(4+) (PubChem CID 173327045) has the molecular formula C23H30O3Zr and a molecular weight of 445.71 g/mol. Its IUPAC name is di(cyclopenta-1,3-dien-1-yl)methylbenzene;ethanolate;zirconium(4+).
| Compound Name | di(cyclopenta-1,3-dien-1-yl)methylbenzene;ethanolate;zirconium(4+) |
|---|---|
| PubChem CID | 173327045 |
| Molecular Formula | C23H30O3Zr |
| Molecular Weight | 445.71 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | di(cyclopenta-1,3-dien-1-yl)methylbenzene;ethanolate;zirconium(4+) |
| SMILES | C1=CCC([C-](C2=CC=CC2)c2ccccc2)=C1.CC[O-].CC[O-].CC[O-].[Zr+4] |
| InChI | InChI=1S/C17H15.3C2H5O.Zr/c1-2-8-14(9-3-1)17(15-10-4-5-11-15)16-12-6-7-13-16;3*1-2-3;/h1-10,12H,11,13H2;3*2H2,1H3;/q4*-1;+4 |
| InChIKey | GFHAMVFWKFBPLZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.71 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|