C10H13Ni- — CID 173188545
nickel;1-pent-1-en-3-ylcyclopenta-1,3-diene (PubChem CID 173188545) has the molecular formula C10H13Ni- and a molecular weight of 191.91 g/mol. Its IUPAC name is nickel;1-pent-1-en-3-ylcyclopenta-1,3-diene.
| Compound Name | nickel;1-pent-1-en-3-ylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 173188545 |
| Molecular Formula | C10H13Ni- |
| Molecular Weight | 191.91 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | nickel;1-pent-1-en-3-ylcyclopenta-1,3-diene |
| SMILES | C=C[C-](CC)C1=CC=CC1.[Ni] |
| InChI | InChI=1S/C10H13.Ni/c1-3-9(4-2)10-7-5-6-8-10;/h3,5-7H,1,4,8H2,2H3;/q-1; |
| InChIKey | AARJDJMYUKNZPU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.91 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|